C25H35BN3O4Si+ — CID 59188063
2-[[3-(2-methoxycyclohexa-1,3,5-trien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 59188063) has the molecular formula C25H35BN3O4Si+ and a molecular weight of 480.47 g/mol. Its IUPAC name is 2-[[3-(2-methoxycyclohexa-1,3,5-trien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2-methoxycyclohexa-1,3,5-trien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 59188063 |
| Molecular Formula | C25H35BN3O4Si+ |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2-[[3-(2-methoxycyclohexa-1,3,5-trien-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COC1=C(c2nn(COCC[Si](C)(C)C)c3ncc(B4OC(C)(C)C(C)(C)O4)cc23)C=C[C+]=C1 |
| InChI | InChI=1S/C25H35BN3O4Si/c1-24(2)25(3,4)33-26(32-24)18-15-20-22(19-11-9-10-12-21(19)30-5)28-29(23(20)27-16-18)17-31-13-14-34(6,7)8/h9,11-12,15-16H,13-14,17H2,1-8H3/q+1 |
| InChIKey | HWJYIVOWVHHEDM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|