C16H19N2O3P — CID 59188796
benzyl N-[[methyl(pyridin-2-ylmethyl)phosphoryl]methyl]carbamate (PubChem CID 59188796) has the molecular formula C16H19N2O3P and a molecular weight of 318.31 g/mol. Its IUPAC name is benzyl N-[[methyl(pyridin-2-ylmethyl)phosphoryl]methyl]carbamate.
| Compound Name | benzyl N-[[methyl(pyridin-2-ylmethyl)phosphoryl]methyl]carbamate |
|---|---|
| PubChem CID | 59188796 |
| Molecular Formula | C16H19N2O3P |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | benzyl N-[[methyl(pyridin-2-ylmethyl)phosphoryl]methyl]carbamate |
| SMILES | CP(=O)(CNC(=O)OCc1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C16H19N2O3P/c1-22(20,12-15-9-5-6-10-17-15)13-18-16(19)21-11-14-7-3-2-4-8-14/h2-10H,11-13H2,1H3,(H,18,19) |
| InChIKey | OSDUAKHYMMEXAP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|