C16H19N2O4PS — CID 70829352
methyl-[[4-(phenylmethoxycarbonylaminomethyl)-2-pyridinyl]sulfanylmethyl]phosphinic acid (PubChem CID 70829352) has the molecular formula C16H19N2O4PS and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl-[[4-(phenylmethoxycarbonylaminomethyl)-2-pyridinyl]sulfanylmethyl]phosphinic acid.
| Compound Name | methyl-[[4-(phenylmethoxycarbonylaminomethyl)-2-pyridinyl]sulfanylmethyl]phosphinic acid |
|---|---|
| PubChem CID | 70829352 |
| Molecular Formula | C16H19N2O4PS |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | methyl-[[4-(phenylmethoxycarbonylaminomethyl)-2-pyridinyl]sulfanylmethyl]phosphinic acid |
| SMILES | CP(=O)(O)CSc1cc(CNC(=O)OCc2ccccc2)ccn1 |
| InChI | InChI=1S/C16H19N2O4PS/c1-23(20,21)12-24-15-9-14(7-8-17-15)10-18-16(19)22-11-13-5-3-2-4-6-13/h2-9H,10-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YXLUHJCPKCNKHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|