About cyclopentylmethoxymethyl 2-methylbutanoate
cyclopentylmethoxymethyl 2-methylbutanoate (PubChem CID 59189145) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is cyclopentylmethoxymethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | cyclopentylmethoxymethyl 2-methylbutanoate |
| PubChem CID | 59189145 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | cyclopentylmethoxymethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCOCC1CCCC1 |
| InChI | InChI=1S/C12H22O3/c1-3-10(2)12(13)15-9-14-8-11-6-4-5-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | MNTCKLQXVOALLQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethoxymethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethoxymethyl 2-methylbutanoate?
The IUPAC name of cyclopentylmethoxymethyl 2-methylbutanoate (CID 59189145) is cyclopentylmethoxymethyl 2-methylbutanoate.
What is the SMILES notation for cyclopentylmethoxymethyl 2-methylbutanoate?
The canonical SMILES for cyclopentylmethoxymethyl 2-methylbutanoate is CCC(C)C(=O)OCOCC1CCCC1.
What is the InChIKey of cyclopentylmethoxymethyl 2-methylbutanoate?
The InChIKey is MNTCKLQXVOALLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-3-10(2)12(13)15-9-14-8-11-6-4-5-7-11/h10-11H,3-9H2,1-2H3.
What are the key properties of cyclopentylmethoxymethyl 2-methylbutanoate?
cyclopentylmethoxymethyl 2-methylbutanoate has a molecular weight of 214.30 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethoxymethyl 2-methylbutanoate is sourced from PubChem (CID 59189145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).