C27H20ClN5O3 — CID 59193083
[(1R,2S)-1-(3-chloro-4-isocyano-2-methylanilino)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]propan-2-yl] benzoate (PubChem CID 59193083) has the molecular formula C27H20ClN5O3 and a molecular weight of 497.94 g/mol. Its IUPAC name is [(1R,2S)-1-(3-chloro-4-isocyano-2-methylanilino)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]propan-2-yl] benzoate.
| Compound Name | [(1R,2S)-1-(3-chloro-4-isocyano-2-methylanilino)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]propan-2-yl] benzoate |
|---|---|
| PubChem CID | 59193083 |
| Molecular Formula | C27H20ClN5O3 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [(1R,2S)-1-(3-chloro-4-isocyano-2-methylanilino)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]propan-2-yl] benzoate |
| SMILES | [C-]#[N+]c1ccc(N[C@@H](c2nnc(-c3ccc(C#N)cc3)o2)[C@H](C)OC(=O)c2ccccc2)c(C)c1Cl |
| InChI | InChI=1S/C27H20ClN5O3/c1-16-21(13-14-22(30-3)23(16)28)31-24(17(2)35-27(34)20-7-5-4-6-8-20)26-33-32-25(36-26)19-11-9-18(15-29)10-12-19/h4-14,17,24,31H,1-2H3/t17-,24+/m0/s1 |
| InChIKey | VISRHRDWMYHYTR-BXKMTCNYSA-N |
| XLogP | 6.52 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|