C26H14F2N2 — CID 59194444
[2,7-bis(4-fluorophenyl)fluoren-9-ylidene]cyanamide (PubChem CID 59194444) has the molecular formula C26H14F2N2 and a molecular weight of 392.41 g/mol. Its IUPAC name is [2,7-bis(4-fluorophenyl)fluoren-9-ylidene]cyanamide.
| Compound Name | [2,7-bis(4-fluorophenyl)fluoren-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 59194444 |
| Molecular Formula | C26H14F2N2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2,7-bis(4-fluorophenyl)fluoren-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2cc(-c3ccc(F)cc3)ccc2-c2ccc(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C26H14F2N2/c27-20-7-1-16(2-8-20)18-5-11-22-23-12-6-19(17-3-9-21(28)10-4-17)14-25(23)26(30-15-29)24(22)13-18/h1-14H |
| InChIKey | UCUWFVOOCOBGEM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|