C45H39NSi — CID 59194817
3-[10-(9,9-dimethylfluoren-3-yl)-3-methylanthracen-9-yl]-5,10,10-trimethylbenzo[b][1,4]benzazasiline (PubChem CID 59194817) has the molecular formula C45H39NSi and a molecular weight of 621.90 g/mol. Its IUPAC name is 3-[10-(9,9-dimethylfluoren-3-yl)-3-methylanthracen-9-yl]-5,10,10-trimethylbenzo[b][1,4]benzazasiline.
| Compound Name | 3-[10-(9,9-dimethylfluoren-3-yl)-3-methylanthracen-9-yl]-5,10,10-trimethylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 59194817 |
| Molecular Formula | C45H39NSi |
| Molecular Weight | 621.90 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 3-[10-(9,9-dimethylfluoren-3-yl)-3-methylanthracen-9-yl]-5,10,10-trimethylbenzo[b][1,4]benzazasiline |
| SMILES | Cc1ccc2c(-c3ccc4c(c3)N(C)c3ccccc3[Si]4(C)C)c3ccccc3c(-c3ccc4c(c3)-c3ccccc3C4(C)C)c2c1 |
| InChI | InChI=1S/C45H39NSi/c1-28-19-22-34-36(25-28)44(29-20-23-38-35(26-29)31-13-9-10-16-37(31)45(38,2)3)33-15-8-7-14-32(33)43(34)30-21-24-42-40(27-30)46(4)39-17-11-12-18-41(39)47(42,5)6/h7-27H,1-6H3 |
| InChIKey | REYBMMMEDQLYHA-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.90 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|