C78H57N3 — CID 59196957
N-[3-[3,5-bis[3-(4-phenyl-N-(3-tritiophenyl)anilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)-3-tritioaniline (PubChem CID 59196957) has the molecular formula C78H57N3 and a molecular weight of 1042.36 g/mol. Its IUPAC name is N-[3-[3,5-bis[3-(4-phenyl-N-(3-tritiophenyl)anilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)-3-tritioaniline.
| Compound Name | N-[3-[3,5-bis[3-(4-phenyl-N-(3-tritiophenyl)anilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)-3-tritioaniline |
|---|---|
| PubChem CID | 59196957 |
| Molecular Formula | C78H57N3 |
| Molecular Weight | 1042.36 g/mol |
| Exact Mass | 1041.48 |
| IUPAC Name | N-[3-[3,5-bis[3-(4-phenyl-N-(3-tritiophenyl)anilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)-3-tritioaniline |
| SMILES | [3H]c1cccc(N(c2ccc(-c3ccccc3)cc2)c2cccc(-c3cc(-c4cccc(N(c5ccc(-c6ccccc6)cc5)c5cccc([3H])c5)c4)cc(-c4cccc(N(c5ccc(-c6ccccc6)cc5)c5cccc([3H])c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C78H57N3/c1-7-22-58(23-8-1)61-40-46-73(47-41-61)79(70-31-13-4-14-32-70)76-37-19-28-64(55-76)67-52-68(65-29-20-38-77(56-65)80(71-33-15-5-16-34-71)74-48-42-62(43-49-74)59-24-9-2-10-25-59)54-69(53-67)66-30-21-39-78(57-66)81(72-35-17-6-18-36-72)75-50-44-63(45-51-75)60-26-11-3-12-27-60/h1-57H/i13T,15T,17T |
| InChIKey | JKQQKWOJLZUJIT-LVNGXNLTSA-N |
| XLogP | 22.10 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.36 |
| LogP ≤ 5 | 22.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |