C30H23N — CID 59196961
3-phenyl-N-(4-phenylphenyl)-N-(3-tritiophenyl)aniline (PubChem CID 59196961) has the molecular formula C30H23N and a molecular weight of 399.53 g/mol. Its IUPAC name is 3-phenyl-N-(4-phenylphenyl)-N-(3-tritiophenyl)aniline.
| Compound Name | 3-phenyl-N-(4-phenylphenyl)-N-(3-tritiophenyl)aniline |
|---|---|
| PubChem CID | 59196961 |
| Molecular Formula | C30H23N |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-phenyl-N-(4-phenylphenyl)-N-(3-tritiophenyl)aniline |
| SMILES | [3H]c1cccc(N(c2ccc(-c3ccccc3)cc2)c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H23N/c1-4-11-24(12-5-1)26-19-21-29(22-20-26)31(28-16-8-3-9-17-28)30-18-10-15-27(23-30)25-13-6-2-7-14-25/h1-23H/i8T |
| InChIKey | QGOACORVIMHDDL-WTRHXODISA-N |
| XLogP | 8.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |