C30H23N — CID 59197011
N-phenyl-4-(3-tritiophenyl)-N-[4-(3-tritiophenyl)phenyl]aniline (PubChem CID 59197011) has the molecular formula C30H23N and a molecular weight of 401.54 g/mol. Its IUPAC name is N-phenyl-4-(3-tritiophenyl)-N-[4-(3-tritiophenyl)phenyl]aniline.
| Compound Name | N-phenyl-4-(3-tritiophenyl)-N-[4-(3-tritiophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 59197011 |
| Molecular Formula | C30H23N |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-phenyl-4-(3-tritiophenyl)-N-[4-(3-tritiophenyl)phenyl]aniline |
| SMILES | [3H]c1cccc(-c2ccc(N(c3ccccc3)c3ccc(-c4cccc([3H])c4)cc3)cc2)c1 |
| InChI | InChI=1S/C30H23N/c1-4-10-24(11-5-1)26-16-20-29(21-17-26)31(28-14-8-3-9-15-28)30-22-18-27(19-23-30)25-12-6-2-7-13-25/h1-23H/i4T,6T |
| InChIKey | VXKVZTGWNITVPY-OOXUDHARSA-N |
| XLogP | 8.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |