C19H22FN3O2 — CID 59200619
methyl 2-(2-fluoroanilino)-2-(6-piperidin-1-yl-3-pyridinyl)acetate (PubChem CID 59200619) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is methyl 2-(2-fluoroanilino)-2-(6-piperidin-1-yl-3-pyridinyl)acetate.
| Compound Name | methyl 2-(2-fluoroanilino)-2-(6-piperidin-1-yl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 59200619 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | methyl 2-(2-fluoroanilino)-2-(6-piperidin-1-yl-3-pyridinyl)acetate |
| SMILES | COC(=O)C(Nc1ccccc1F)c1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-25-19(24)18(22-16-8-4-3-7-15(16)20)14-9-10-17(21-13-14)23-11-5-2-6-12-23/h3-4,7-10,13,18,22H,2,5-6,11-12H2,1H3 |
| InChIKey | FJXHLRBSKRTPJR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |