C19H19N2O6PS — CID 59202677
2-[[4-[[4-(carboxymethylcarbamoyl)phenyl]-(sulfanylmethyl)phosphanyl]benzoyl]amino]acetic acid (PubChem CID 59202677) has the molecular formula C19H19N2O6PS and a molecular weight of 434.41 g/mol. Its IUPAC name is 2-[[4-[[4-(carboxymethylcarbamoyl)phenyl]-(sulfanylmethyl)phosphanyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[4-(carboxymethylcarbamoyl)phenyl]-(sulfanylmethyl)phosphanyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 59202677 |
| Molecular Formula | C19H19N2O6PS |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[[4-[[4-(carboxymethylcarbamoyl)phenyl]-(sulfanylmethyl)phosphanyl]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(P(CS)c2ccc(C(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H19N2O6PS/c22-16(23)9-20-18(26)12-1-5-14(6-2-12)28(11-29)15-7-3-13(4-8-15)19(27)21-10-17(24)25/h1-8,29H,9-11H2,(H,20,26)(H,21,27)(H,22,23)(H,24,25) |
| InChIKey | ZVBMNACXXCJFNB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|