C18H24NO2Y- — CID 59207919
(4R)-1-hexyl-4-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)azetidin-2-one;yttrium (PubChem CID 59207919) has the molecular formula C18H24NO2Y- and a molecular weight of 375.30 g/mol. Its IUPAC name is (4R)-1-hexyl-4-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)azetidin-2-one;yttrium.
| Compound Name | (4R)-1-hexyl-4-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)azetidin-2-one;yttrium |
|---|---|
| PubChem CID | 59207919 |
| Molecular Formula | C18H24NO2Y- |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (4R)-1-hexyl-4-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)azetidin-2-one;yttrium |
| SMILES | [CH2-]CCCCCN1C(=O)C[C@@H]1c1ccc2c(c1)CCC2O.[Y] |
| InChI | InChI=1S/C18H24NO2.Y/c1-2-3-4-5-10-19-16(12-18(19)21)14-6-8-15-13(11-14)7-9-17(15)20;/h6,8,11,16-17,20H,1-5,7,9-10,12H2;/q-1;/t16-,17?;/m1./s1 |
| InChIKey | INEIHTFNHBKBCX-RBMDBAKPSA-N |
| XLogP | 3.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|