C19H25NO4 — CID 11963068
7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]heptanoic acid (PubChem CID 11963068) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 11963068 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 7-[(2R)-2-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)-4-oxoazetidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)C[C@@H]1c1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C19H25NO4/c21-17-9-7-13-11-14(6-8-15(13)17)16-12-18(22)20(16)10-4-2-1-3-5-19(23)24/h6,8,11,16-17,21H,1-5,7,9-10,12H2,(H,23,24)/t16-,17?/m1/s1 |
| InChIKey | VFWNDEXKCCGQRD-TZHYSIJRSA-N |
| XLogP | 2.97 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|