C29H28F3N3O2S — CID 59209498
N,N-bis(prop-2-enyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209498) has the molecular formula C29H28F3N3O2S and a molecular weight of 539.62 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N,N-bis(prop-2-enyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209498 |
| Molecular Formula | C29H28F3N3O2S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N,N-bis(prop-2-enyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1csc(C2CCN(C(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)CC2)n1 |
| InChI | InChI=1S/C29H28F3N3O2S/c1-3-15-34(16-4-2)28(37)25-19-38-26(33-25)21-13-17-35(18-14-21)27(36)24-8-6-5-7-23(24)20-9-11-22(12-10-20)29(30,31)32/h3-12,19,21H,1-2,13-18H2 |
| InChIKey | PZKLPVAKSIXWHS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|