C29H29F4N3O2S — CID 142983171
2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[(E)-2,2-difluoropent-3-enyl]-1,3-thiazole-4-carboxamide (PubChem CID 142983171) has the molecular formula C29H29F4N3O2S and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[(E)-2,2-difluoropent-3-enyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[(E)-2,2-difluoropent-3-enyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142983171 |
| Molecular Formula | C29H29F4N3O2S |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[(E)-2,2-difluoropent-3-enyl]-1,3-thiazole-4-carboxamide |
| SMILES | C/C=C/C(F)(F)CNC(=O)c1csc(C2CCN(C(=O)c3ccccc3-c3ccc(C(C)(F)F)cc3)CC2)n1 |
| InChI | InChI=1S/C29H29F4N3O2S/c1-3-14-29(32,33)18-34-25(37)24-17-39-26(35-24)20-12-15-36(16-13-20)27(38)23-7-5-4-6-22(23)19-8-10-21(11-9-19)28(2,30)31/h3-11,14,17,20H,12-13,15-16,18H2,1-2H3,(H,34,37)/b14-3+ |
| InChIKey | BRLDRRYHORHLQP-LZWSPWQCSA-N |
| XLogP | 6.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|