C34H35F2N3O3S — CID 142983022
2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[3-(2-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 142983022) has the molecular formula C34H35F2N3O3S and a molecular weight of 603.74 g/mol. Its IUPAC name is 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[3-(2-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[3-(2-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142983022 |
| Molecular Formula | C34H35F2N3O3S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 2-[1-[2-[4-(1,1-difluoroethyl)phenyl]benzoyl]piperidin-4-yl]-N-[3-(2-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccccc1CCCNC(=O)c1csc(C2CCN(C(=O)c3ccccc3-c3ccc(C(C)(F)F)cc3)CC2)n1 |
| InChI | InChI=1S/C34H35F2N3O3S/c1-34(35,36)26-15-13-23(14-16-26)27-10-4-5-11-28(27)33(41)39-20-17-25(18-21-39)32-38-29(22-43-32)31(40)37-19-7-9-24-8-3-6-12-30(24)42-2/h3-6,8,10-16,22,25H,7,9,17-21H2,1-2H3,(H,37,40) |
| InChIKey | ADLCBLKGRKPJOQ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|