C28H36O4 — CID 59210668
methyl 8-[2-[(4-cyclohexylphenyl)methoxy]phenyl]-6-oxooctanoate (PubChem CID 59210668) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is methyl 8-[2-[(4-cyclohexylphenyl)methoxy]phenyl]-6-oxooctanoate.
| Compound Name | methyl 8-[2-[(4-cyclohexylphenyl)methoxy]phenyl]-6-oxooctanoate |
|---|---|
| PubChem CID | 59210668 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | methyl 8-[2-[(4-cyclohexylphenyl)methoxy]phenyl]-6-oxooctanoate |
| SMILES | COC(=O)CCCCC(=O)CCc1ccccc1OCc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H36O4/c1-31-28(30)14-8-6-12-26(29)20-19-25-11-5-7-13-27(25)32-21-22-15-17-24(18-16-22)23-9-3-2-4-10-23/h5,7,11,13,15-18,23H,2-4,6,8-10,12,14,19-21H2,1H3 |
| InChIKey | NMJDVTFCVYUSEO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|