C52H32N4 — CID 59211069
N-[9,10-bis(2-isocyanophenyl)anthracen-1-yl]-N,9-diphenylcarbazol-3-amine (PubChem CID 59211069) has the molecular formula C52H32N4 and a molecular weight of 712.86 g/mol. Its IUPAC name is N-[9,10-bis(2-isocyanophenyl)anthracen-1-yl]-N,9-diphenylcarbazol-3-amine.
| Compound Name | N-[9,10-bis(2-isocyanophenyl)anthracen-1-yl]-N,9-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 59211069 |
| Molecular Formula | C52H32N4 |
| Molecular Weight | 712.86 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | N-[9,10-bis(2-isocyanophenyl)anthracen-1-yl]-N,9-diphenylcarbazol-3-amine |
| SMILES | [C-]#[N+]c1ccccc1-c1c2ccccc2c(-c2ccccc2[N+]#[C-])c2c(N(c3ccccc3)c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cccc12 |
| InChI | InChI=1S/C52H32N4/c1-53-45-28-14-11-25-41(45)50-39-23-9-10-24-40(39)51(42-26-12-15-29-46(42)54-2)52-43(50)27-17-31-49(52)55(35-18-5-3-6-19-35)37-32-33-48-44(34-37)38-22-13-16-30-47(38)56(48)36-20-7-4-8-21-36/h3-34H |
| InChIKey | VJSASFVSUOYMCV-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 16.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.86 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|