C22H14F3N5O — CID 59213016
N-(1H-indazol-3-yl)-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine (PubChem CID 59213016) has the molecular formula C22H14F3N5O and a molecular weight of 421.38 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine.
| Compound Name | N-(1H-indazol-3-yl)-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59213016 |
| Molecular Formula | C22H14F3N5O |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(1H-indazol-3-yl)-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine |
| SMILES | FC(F)(F)Oc1ccccc1-c1nc(Nc2n[nH]c3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C22H14F3N5O/c23-22(24,25)31-18-12-6-3-9-15(18)20-26-16-10-4-1-7-13(16)19(27-20)28-21-14-8-2-5-11-17(14)29-30-21/h1-12H,(H2,26,27,28,29,30) |
| InChIKey | OGVJBTXGCIBHOL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |