C23H18FN5 — CID 59212894
2-(2-ethylphenyl)-N-(5-fluoro-1H-indazol-3-yl)quinazolin-4-amine (PubChem CID 59212894) has the molecular formula C23H18FN5 and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-N-(5-fluoro-1H-indazol-3-yl)quinazolin-4-amine.
| Compound Name | 2-(2-ethylphenyl)-N-(5-fluoro-1H-indazol-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 59212894 |
| Molecular Formula | C23H18FN5 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(2-ethylphenyl)-N-(5-fluoro-1H-indazol-3-yl)quinazolin-4-amine |
| SMILES | CCc1ccccc1-c1nc(Nc2n[nH]c3ccc(F)cc23)c2ccccc2n1 |
| InChI | InChI=1S/C23H18FN5/c1-2-14-7-3-4-8-16(14)21-25-19-10-6-5-9-17(19)22(26-21)27-23-18-13-15(24)11-12-20(18)28-29-23/h3-13H,2H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | REYIBBDVFVCBBO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |