C17H15FN6 — CID 6401717
[8-fluoro-5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]hydrazine (PubChem CID 6401717) has the molecular formula C17H15FN6 and a molecular weight of 322.35 g/mol. Its IUPAC name is [8-fluoro-5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]hydrazine.
| Compound Name | [8-fluoro-5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]hydrazine |
|---|---|
| PubChem CID | 6401717 |
| Molecular Formula | C17H15FN6 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [8-fluoro-5-(2-phenylethyl)-[1,2,4]triazino[5,6-b]indol-3-yl]hydrazine |
| SMILES | NNc1nnc2c3cc(F)ccc3n(CCc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H15FN6/c18-12-6-7-14-13(10-12)15-16(20-17(21-19)23-22-15)24(14)9-8-11-4-2-1-3-5-11/h1-7,10H,8-9,19H2,(H,20,21,23) |
| InChIKey | HHZKRGCZJOURAP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|