C13H18NRe- — CID 59218238
2-tert-butyl-3,4-dihydro-1H-isoquinolin-4-ide;rhenium (PubChem CID 59218238) has the molecular formula C13H18NRe- and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-tert-butyl-3,4-dihydro-1H-isoquinolin-4-ide;rhenium.
| Compound Name | 2-tert-butyl-3,4-dihydro-1H-isoquinolin-4-ide;rhenium |
|---|---|
| PubChem CID | 59218238 |
| Molecular Formula | C13H18NRe- |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-tert-butyl-3,4-dihydro-1H-isoquinolin-4-ide;rhenium |
| SMILES | CC(C)(C)N1C[CH-]c2ccccc2C1.[Re] |
| InChI | InChI=1S/C13H18N.Re/c1-13(2,3)14-9-8-11-6-4-5-7-12(11)10-14;/h4-8H,9-10H2,1-3H3;/q-1; |
| InChIKey | RXMMDHOXZLKHSL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|