C60H54N4 — CID 59219640
5-[9,10-bis(4-tert-butylphenyl)-6-(10-methylphenazin-5-yl)anthracen-2-yl]-10-methylphenazine (PubChem CID 59219640) has the molecular formula C60H54N4 and a molecular weight of 831.12 g/mol. Its IUPAC name is 5-[9,10-bis(4-tert-butylphenyl)-6-(10-methylphenazin-5-yl)anthracen-2-yl]-10-methylphenazine.
| Compound Name | 5-[9,10-bis(4-tert-butylphenyl)-6-(10-methylphenazin-5-yl)anthracen-2-yl]-10-methylphenazine |
|---|---|
| PubChem CID | 59219640 |
| Molecular Formula | C60H54N4 |
| Molecular Weight | 831.12 g/mol |
| Exact Mass | 830.43 |
| IUPAC Name | 5-[9,10-bis(4-tert-butylphenyl)-6-(10-methylphenazin-5-yl)anthracen-2-yl]-10-methylphenazine |
| SMILES | CN1c2ccccc2N(c2ccc3c(-c4ccc(C(C)(C)C)cc4)c4cc(N5c6ccccc6N(C)c6ccccc65)ccc4c(-c4ccc(C(C)(C)C)cc4)c3c2)c2ccccc21 |
| InChI | InChI=1S/C60H54N4/c1-59(2,3)41-29-25-39(26-30-41)57-45-35-33-44(64-55-23-15-11-19-51(55)62(8)52-20-12-16-24-56(52)64)38-48(45)58(40-27-31-42(32-28-40)60(4,5)6)46-36-34-43(37-47(46)57)63-53-21-13-9-17-49(53)61(7)50-18-10-14-22-54(50)63/h9-38H,1-8H3 |
| InChIKey | HQIRNZSOCGZHGN-UHFFFAOYSA-N |
| XLogP | 17.02 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.12 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|