C56H48N6 — CID 59220486
2-[3-[10-(3,5-dipyridin-2-ylphenyl)-2,6-di(piperidin-1-yl)anthracen-9-yl]-5-pyridin-2-ylphenyl]pyridine (PubChem CID 59220486) has the molecular formula C56H48N6 and a molecular weight of 805.04 g/mol. Its IUPAC name is 2-[3-[10-(3,5-dipyridin-2-ylphenyl)-2,6-di(piperidin-1-yl)anthracen-9-yl]-5-pyridin-2-ylphenyl]pyridine.
| Compound Name | 2-[3-[10-(3,5-dipyridin-2-ylphenyl)-2,6-di(piperidin-1-yl)anthracen-9-yl]-5-pyridin-2-ylphenyl]pyridine |
|---|---|
| PubChem CID | 59220486 |
| Molecular Formula | C56H48N6 |
| Molecular Weight | 805.04 g/mol |
| Exact Mass | 804.39 |
| IUPAC Name | 2-[3-[10-(3,5-dipyridin-2-ylphenyl)-2,6-di(piperidin-1-yl)anthracen-9-yl]-5-pyridin-2-ylphenyl]pyridine |
| SMILES | c1ccc(-c2cc(-c3ccccn3)cc(-c3c4ccc(N5CCCCC5)cc4c(-c4cc(-c5ccccn5)cc(-c5ccccn5)c4)c4ccc(N5CCCCC5)cc34)c2)nc1 |
| InChI | InChI=1S/C56H48N6/c1-11-27-61(28-12-1)45-19-21-47-49(37-45)55(43-33-39(51-15-3-7-23-57-51)31-40(34-43)52-16-4-8-24-58-52)48-22-20-46(62-29-13-2-14-30-62)38-50(48)56(47)44-35-41(53-17-5-9-25-59-53)32-42(36-44)54-18-6-10-26-60-54/h3-10,15-26,31-38H,1-2,11-14,27-30H2 |
| InChIKey | BERAJYNZSSNEFR-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.04 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|