C40H18F10N2 — CID 59222048
1-N,6-N-bis(4-deuteriophenyl)-1-N,6-N-bis(2,3,4,5,6-pentafluorophenyl)pyrene-1,6-diamine (PubChem CID 59222048) has the molecular formula C40H18F10N2 and a molecular weight of 718.59 g/mol. Its IUPAC name is 1-N,6-N-bis(4-deuteriophenyl)-1-N,6-N-bis(2,3,4,5,6-pentafluorophenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(4-deuteriophenyl)-1-N,6-N-bis(2,3,4,5,6-pentafluorophenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59222048 |
| Molecular Formula | C40H18F10N2 |
| Molecular Weight | 718.59 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 1-N,6-N-bis(4-deuteriophenyl)-1-N,6-N-bis(2,3,4,5,6-pentafluorophenyl)pyrene-1,6-diamine |
| SMILES | [2H]c1ccc(N(c2c(F)c(F)c(F)c(F)c2F)c2ccc3ccc4c(N(c5ccc([2H])cc5)c5c(F)c(F)c(F)c(F)c5F)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C40H18F10N2/c41-29-31(43)35(47)39(36(48)32(29)44)51(21-7-3-1-4-8-21)25-17-13-19-12-16-24-26(18-14-20-11-15-23(25)27(19)28(20)24)52(22-9-5-2-6-10-22)40-37(49)33(45)30(42)34(46)38(40)50/h1-18H/i1D,2D |
| InChIKey | DJFIGEGMAZGANU-QDNHWIQGSA-N |
| XLogP | 12.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.59 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|