C42H26F6N2 — CID 59222073
1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine (PubChem CID 59222073) has the molecular formula C42H26F6N2 and a molecular weight of 682.73 g/mol. Its IUPAC name is 1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59222073 |
| Molecular Formula | C42H26F6N2 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(C(F)(F)F)cc2)c2ccc3ccc4c(N(c5ccc(C(F)(F)F)cc5)c5c([2H])c([2H])c([2H])c([2H])c5[2H])ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C42H26F6N2/c43-41(44,45)29-15-19-33(20-16-29)49(31-7-3-1-4-8-31)37-25-13-27-12-24-36-38(26-14-28-11-23-35(37)39(27)40(28)36)50(32-9-5-2-6-10-32)34-21-17-30(18-22-34)42(46,47)48/h1-26H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | FAOQOZQAPUTECP-LHNTUAQVSA-N |
| XLogP | 13.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|