C68H50F2N2 — CID 59358131
1-N,6-N-bis[2-fluoro-4,5-bis(4-methylphenyl)phenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine (PubChem CID 59358131) has the molecular formula C68H50F2N2 and a molecular weight of 943.22 g/mol. Its IUPAC name is 1-N,6-N-bis[2-fluoro-4,5-bis(4-methylphenyl)phenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2-fluoro-4,5-bis(4-methylphenyl)phenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59358131 |
| Molecular Formula | C68H50F2N2 |
| Molecular Weight | 943.22 g/mol |
| Exact Mass | 942.46 |
| IUPAC Name | 1-N,6-N-bis[2-fluoro-4,5-bis(4-methylphenyl)phenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2cc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)cc2F)c2ccc3ccc4c(N(c5cc(-c6ccc(C)cc6)c(-c6ccc(C)cc6)cc5F)c5c([2H])c([2H])c([2H])c([2H])c5[2H])ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C68H50F2N2/c1-43-15-23-47(24-16-43)57-39-61(69)65(41-59(57)49-27-19-45(3)20-28-49)71(53-11-7-5-8-12-53)63-37-33-51-32-36-56-64(38-34-52-31-35-55(63)67(51)68(52)56)72(54-13-9-6-10-14-54)66-42-60(50-29-21-46(4)22-30-50)58(40-62(66)70)48-25-17-44(2)18-26-48/h5-42H,1-4H3/i5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| InChIKey | CDUHGNMCABSLKM-FBOMCFBCSA-N |
| XLogP | 19.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.22 |
| LogP ≤ 5 | 19.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|