C72H58F2N2 — CID 59357978
1-N,6-N-bis[3,5-bis(2,6-dimethylphenyl)-2-fluorophenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine (PubChem CID 59357978) has the molecular formula C72H58F2N2 and a molecular weight of 999.33 g/mol. Its IUPAC name is 1-N,6-N-bis[3,5-bis(2,6-dimethylphenyl)-2-fluorophenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[3,5-bis(2,6-dimethylphenyl)-2-fluorophenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59357978 |
| Molecular Formula | C72H58F2N2 |
| Molecular Weight | 999.33 g/mol |
| Exact Mass | 998.52 |
| IUPAC Name | 1-N,6-N-bis[3,5-bis(2,6-dimethylphenyl)-2-fluorophenyl]-1-N,6-N-bis(2,3,4,5,6-pentadeuteriophenyl)pyrene-1,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2cc(-c3c(C)cccc3C)cc(-c3c(C)cccc3C)c2F)c2ccc3ccc4c(N(c5cc(-c6c(C)cccc6C)cc(-c6c(C)cccc6C)c5F)c5c([2H])c([2H])c([2H])c([2H])c5[2H])ccc5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C72H58F2N2/c1-43-19-15-20-44(2)65(43)53-39-59(67-47(5)23-17-24-48(67)6)71(73)63(41-53)75(55-27-11-9-12-28-55)61-37-33-51-32-36-58-62(38-34-52-31-35-57(61)69(51)70(52)58)76(56-29-13-10-14-30-56)64-42-54(66-45(3)21-16-22-46(66)4)40-60(72(64)74)68-49(7)25-18-26-50(68)8/h9-42H,1-8H3/i9D,10D,11D,12D,13D,14D,27D,28D,29D,30D |
| InChIKey | WMNMAPJTEKKIHW-IBKRXIJNSA-N |
| XLogP | 20.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.33 |
| LogP ≤ 5 | 20.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|