C18H22NO2Y- — CID 59226740
4-methoxy-8-methyl-3-(2-methylbenzene-5-id-1-yl)-1-azaspiro[4.5]dec-3-en-2-one;yttrium (PubChem CID 59226740) has the molecular formula C18H22NO2Y- and a molecular weight of 373.29 g/mol. Its IUPAC name is 4-methoxy-8-methyl-3-(2-methylbenzene-5-id-1-yl)-1-azaspiro[4.5]dec-3-en-2-one;yttrium.
| Compound Name | 4-methoxy-8-methyl-3-(2-methylbenzene-5-id-1-yl)-1-azaspiro[4.5]dec-3-en-2-one;yttrium |
|---|---|
| PubChem CID | 59226740 |
| Molecular Formula | C18H22NO2Y- |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-methoxy-8-methyl-3-(2-methylbenzene-5-id-1-yl)-1-azaspiro[4.5]dec-3-en-2-one;yttrium |
| SMILES | COC1=C(c2c[c-]ccc2C)C(=O)NC12CCC(C)CC2.[Y] |
| InChI | InChI=1S/C18H22NO2.Y/c1-12-8-10-18(11-9-12)16(21-3)15(17(20)19-18)14-7-5-4-6-13(14)2;/h4,6-7,12H,8-11H2,1-3H3,(H,19,20);/q-1; |
| InChIKey | OAMJKIFKGIBHMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|