C21H33N3OS — CID 59230249
1-[4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]phenyl]pyrrolidin-2-one (PubChem CID 59230249) has the molecular formula C21H33N3OS and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-[4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 59230249 |
| Molecular Formula | C21H33N3OS |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[4-[[4-(tert-butylsulfanylamino)cyclohexyl]methylamino]phenyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)SNC1CCC(CNc2ccc(N3CCCC3=O)cc2)CC1 |
| InChI | InChI=1S/C21H33N3OS/c1-21(2,3)26-23-18-8-6-16(7-9-18)15-22-17-10-12-19(13-11-17)24-14-4-5-20(24)25/h10-13,16,18,22-23H,4-9,14-15H2,1-3H3 |
| InChIKey | LNKSBIZQGLJIDX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|