C73H58N2 — CID 59236577
9,9,10-trimethyl-3-[4-[(E)-2-[7'-[(E)-2-[4-(9,9,10-trimethylacridin-3-yl)phenyl]ethenyl]-9,9'-spirobi[fluorene]-2'-yl]ethenyl]phenyl]acridine (PubChem CID 59236577) has the molecular formula C73H58N2 and a molecular weight of 963.28 g/mol. Its IUPAC name is 9,9,10-trimethyl-3-[4-[(E)-2-[7'-[(E)-2-[4-(9,9,10-trimethylacridin-3-yl)phenyl]ethenyl]-9,9'-spirobi[fluorene]-2'-yl]ethenyl]phenyl]acridine.
| Compound Name | 9,9,10-trimethyl-3-[4-[(E)-2-[7'-[(E)-2-[4-(9,9,10-trimethylacridin-3-yl)phenyl]ethenyl]-9,9'-spirobi[fluorene]-2'-yl]ethenyl]phenyl]acridine |
|---|---|
| PubChem CID | 59236577 |
| Molecular Formula | C73H58N2 |
| Molecular Weight | 963.28 g/mol |
| Exact Mass | 962.46 |
| IUPAC Name | 9,9,10-trimethyl-3-[4-[(E)-2-[7'-[(E)-2-[4-(9,9,10-trimethylacridin-3-yl)phenyl]ethenyl]-9,9'-spirobi[fluorene]-2'-yl]ethenyl]phenyl]acridine |
| SMILES | CN1c2ccccc2C(C)(C)c2ccc(-c3ccc(/C=C/c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4cc(/C=C/c6ccc(-c7ccc8c(c7)N(C)c7ccccc7C8(C)C)cc6)ccc4-5)cc3)cc21 |
| InChI | InChI=1S/C73H58N2/c1-71(2)61-19-11-13-21-67(61)74(5)69-45-53(37-41-63(69)71)51-33-27-47(28-34-51)23-25-49-31-39-57-58-40-32-50(44-66(58)73(65(57)43-49)59-17-9-7-15-55(59)56-16-8-10-18-60(56)73)26-24-48-29-35-52(36-30-48)54-38-42-64-70(46-54)75(6)68-22-14-12-20-62(68)72(64,3)4/h7-46H,1-6H3/b25-23+,26-24+ |
| InChIKey | HQUAUCOVXTUUHG-OGGGYYITSA-N |
| XLogP | 18.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.28 |
| LogP ≤ 5 | 18.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|