C40H46N4O8S — CID 59237559
(2-hydroxy-3-nitrooxypropyl) 3-[3-tert-butylsulfanyl-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate (PubChem CID 59237559) has the molecular formula C40H46N4O8S and a molecular weight of 742.90 g/mol. Its IUPAC name is (2-hydroxy-3-nitrooxypropyl) 3-[3-tert-butylsulfanyl-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate.
| Compound Name | (2-hydroxy-3-nitrooxypropyl) 3-[3-tert-butylsulfanyl-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59237559 |
| Molecular Formula | C40H46N4O8S |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.30 |
| IUPAC Name | (2-hydroxy-3-nitrooxypropyl) 3-[3-tert-butylsulfanyl-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
| SMILES | CCOc1ccc(-c2ccc(Cn3c(CC(C)(C)C(=O)OCC(O)CO[N+](=O)[O-])c(SC(C)(C)C)c4cc(OCc5ccccn5)ccc43)cc2)cn1 |
| InChI | InChI=1S/C40H46N4O8S/c1-7-49-36-18-15-29(22-42-36)28-13-11-27(12-14-28)23-43-34-17-16-32(50-24-30-10-8-9-19-41-30)20-33(34)37(53-39(2,3)4)35(43)21-40(5,6)38(46)51-25-31(45)26-52-44(47)48/h8-20,22,31,45H,7,21,23-26H2,1-6H3 |
| InChIKey | ASCFKPVUMJYNHG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|