C45H57N3O4S — CID 91099215
3-[3-(4-butyloctylsulfanyl)-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 91099215) has the molecular formula C45H57N3O4S and a molecular weight of 736.04 g/mol. Its IUPAC name is 3-[3-(4-butyloctylsulfanyl)-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-(4-butyloctylsulfanyl)-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 91099215 |
| Molecular Formula | C45H57N3O4S |
| Molecular Weight | 736.04 g/mol |
| Exact Mass | 735.41 |
| IUPAC Name | 3-[3-(4-butyloctylsulfanyl)-1-[[4-(6-ethoxy-3-pyridinyl)phenyl]methyl]-5-(pyridin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCCCC(CCCC)CCCSc1c(CC(C)(C)C(=O)O)n(Cc2ccc(-c3ccc(OCC)nc3)cc2)c2ccc(OCc3ccccn3)cc12 |
| InChI | InChI=1S/C45H57N3O4S/c1-6-9-14-33(15-10-7-2)16-13-27-53-43-39-28-38(52-32-37-17-11-12-26-46-37)23-24-40(39)48(41(43)29-45(4,5)44(49)50)31-34-18-20-35(21-19-34)36-22-25-42(47-30-36)51-8-3/h11-12,17-26,28,30,33H,6-10,13-16,27,29,31-32H2,1-5H3,(H,49,50) |
| InChIKey | QGBYOGDUCFBZLP-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.04 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|