C34H35ClN2O3S — CID 67200092
3-[3-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 67200092) has the molecular formula C34H35ClN2O3S and a molecular weight of 587.19 g/mol. Its IUPAC name is 3-[3-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 67200092 |
| Molecular Formula | C34H35ClN2O3S |
| Molecular Weight | 587.19 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 3-[3-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCCCSc1c(CC(C)(C)C(=O)O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12 |
| InChI | InChI=1S/C34H35ClN2O3S/c1-4-5-18-41-32-28-19-27(40-22-26-15-12-24-8-6-7-9-29(24)36-26)16-17-30(28)37(21-23-10-13-25(35)14-11-23)31(32)20-34(2,3)33(38)39/h6-17,19H,4-5,18,20-22H2,1-3H3,(H,38,39) |
| InChIKey | CIVYXBGKPCVDBC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.19 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|