C34H36ClN3O3S — CID 153261988
amino 3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate (PubChem CID 153261988) has the molecular formula C34H36ClN3O3S and a molecular weight of 602.20 g/mol. Its IUPAC name is amino 3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate.
| Compound Name | amino 3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 153261988 |
| Molecular Formula | C34H36ClN3O3S |
| Molecular Weight | 602.20 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | amino 3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoate |
| SMILES | CC(C)(C)Sc1c(CC(C)(C)C(=O)ON)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12 |
| InChI | InChI=1S/C34H36ClN3O3S/c1-33(2,3)42-31-27-18-26(40-21-25-15-12-23-8-6-7-9-28(23)37-25)16-17-29(27)38(20-22-10-13-24(35)14-11-22)30(31)19-34(4,5)32(39)41-36/h6-18H,19-21,36H2,1-5H3 |
| InChIKey | VCJFDYUTJNXDLZ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.20 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|