C33H33ClN2O4S — CID 18947548
2-[2-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]ethoxy]acetic acid (PubChem CID 18947548) has the molecular formula C33H33ClN2O4S and a molecular weight of 589.16 g/mol. Its IUPAC name is 2-[2-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 18947548 |
| Molecular Formula | C33H33ClN2O4S |
| Molecular Weight | 589.16 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2-[2-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]ethoxy]acetic acid |
| SMILES | CC(C)(C)Sc1c(CCOCC(=O)O)n(Cc2ccc(Cl)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12 |
| InChI | InChI=1S/C33H33ClN2O4S/c1-33(2,3)41-32-27-18-26(40-20-25-13-10-23-6-4-5-7-28(23)35-25)14-15-29(27)36(19-22-8-11-24(34)12-9-22)30(32)16-17-39-21-31(37)38/h4-15,18H,16-17,19-21H2,1-3H3,(H,37,38) |
| InChIKey | VTOHKVXIJZLYLE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.16 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|