C36H37IN2O4 — CID 87696738
3-[3-(3,3-dimethyl-4-oxobutyl)-1-[(4-iodophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 87696738) has the molecular formula C36H37IN2O4 and a molecular weight of 688.61 g/mol. Its IUPAC name is 3-[3-(3,3-dimethyl-4-oxobutyl)-1-[(4-iodophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-(3,3-dimethyl-4-oxobutyl)-1-[(4-iodophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 87696738 |
| Molecular Formula | C36H37IN2O4 |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 3-[3-(3,3-dimethyl-4-oxobutyl)-1-[(4-iodophenyl)methyl]-5-(quinolin-2-ylmethoxy)indol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(C=O)CCc1c(CC(C)(C)C(=O)O)n(Cc2ccc(I)cc2)c2ccc(OCc3ccc4ccccc4n3)cc12 |
| InChI | InChI=1S/C36H37IN2O4/c1-35(2,23-40)18-17-29-30-19-28(43-22-27-14-11-25-7-5-6-8-31(25)38-27)15-16-32(30)39(21-24-9-12-26(37)13-10-24)33(29)20-36(3,4)34(41)42/h5-16,19,23H,17-18,20-22H2,1-4H3,(H,41,42) |
| InChIKey | JQNTUWPGHOXEEA-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|