C30H29Cl2N3O3 — CID 144717193
2-[[1-[(3,4-dichlorophenyl)methyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]oxymethyl]quinoline;formic acid (PubChem CID 144717193) has the molecular formula C30H29Cl2N3O3 and a molecular weight of 550.49 g/mol. Its IUPAC name is 2-[[1-[(3,4-dichlorophenyl)methyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]oxymethyl]quinoline;formic acid.
| Compound Name | 2-[[1-[(3,4-dichlorophenyl)methyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]oxymethyl]quinoline;formic acid |
|---|---|
| PubChem CID | 144717193 |
| Molecular Formula | C30H29Cl2N3O3 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 2-[[1-[(3,4-dichlorophenyl)methyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]oxymethyl]quinoline;formic acid |
| SMILES | CC(C)(C)Cc1nc2cc(OCc3ccc4ccccc4n3)ccc2n1Cc1ccc(Cl)c(Cl)c1.O=CO |
| InChI | InChI=1S/C29H27Cl2N3O.CH2O2/c1-29(2,3)16-28-33-26-15-22(35-18-21-10-9-20-6-4-5-7-25(20)32-21)11-13-27(26)34(28)17-19-8-12-23(30)24(31)14-19;2-1-3/h4-15H,16-18H2,1-3H3;1H,(H,2,3) |
| InChIKey | HMEQHYYPPYYCFF-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|