C30H30N4O2 — CID 144717212
2,2-dimethyl-3-[1-[[4-(methylamino)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]propanal (PubChem CID 144717212) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2,2-dimethyl-3-[1-[[4-(methylamino)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]propanal.
| Compound Name | 2,2-dimethyl-3-[1-[[4-(methylamino)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]propanal |
|---|---|
| PubChem CID | 144717212 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2,2-dimethyl-3-[1-[[4-(methylamino)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]propanal |
| SMILES | CNc1ccc(Cn2c(CC(C)(C)C=O)nc3cc(OCc4ccc5ccccc5n4)ccc32)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-30(2,20-35)17-29-33-27-16-25(36-19-24-13-10-22-6-4-5-7-26(22)32-24)14-15-28(27)34(29)18-21-8-11-23(31-3)12-9-21/h4-16,20,31H,17-19H2,1-3H3 |
| InChIKey | KCWQWMDVHLBBDK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|