C36H36N4O3S — CID 144717203
3-[1-[[4-(4-aminosulfanylphenyl)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]-2,2-dimethylpropanal;methanol (PubChem CID 144717203) has the molecular formula C36H36N4O3S and a molecular weight of 604.78 g/mol. Its IUPAC name is 3-[1-[[4-(4-aminosulfanylphenyl)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]-2,2-dimethylpropanal;methanol.
| Compound Name | 3-[1-[[4-(4-aminosulfanylphenyl)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]-2,2-dimethylpropanal;methanol |
|---|---|
| PubChem CID | 144717203 |
| Molecular Formula | C36H36N4O3S |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 3-[1-[[4-(4-aminosulfanylphenyl)phenyl]methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]-2,2-dimethylpropanal;methanol |
| SMILES | CC(C)(C=O)Cc1nc2cc(OCc3ccc4ccccc4n3)ccc2n1Cc1ccc(-c2ccc(SN)cc2)cc1.CO |
| InChI | InChI=1S/C35H32N4O2S.CH4O/c1-35(2,23-40)20-34-38-32-19-29(41-22-28-14-11-27-5-3-4-6-31(27)37-28)15-18-33(32)39(34)21-24-7-9-25(10-8-24)26-12-16-30(42-36)17-13-26;1-2/h3-19,23H,20-22,36H2,1-2H3;2H,1H3 |
| InChIKey | OSPZDINZQXFDRE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|