C29H24F3N3O3S — CID 59240168
4-(4-isocyanooxan-4-yl)-1-[4-(3-methylsulfonylphenyl)phenyl]-2-[2-(trifluoromethyl)phenyl]imidazole (PubChem CID 59240168) has the molecular formula C29H24F3N3O3S and a molecular weight of 551.59 g/mol. Its IUPAC name is 4-(4-isocyanooxan-4-yl)-1-[4-(3-methylsulfonylphenyl)phenyl]-2-[2-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 4-(4-isocyanooxan-4-yl)-1-[4-(3-methylsulfonylphenyl)phenyl]-2-[2-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 59240168 |
| Molecular Formula | C29H24F3N3O3S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 4-(4-isocyanooxan-4-yl)-1-[4-(3-methylsulfonylphenyl)phenyl]-2-[2-(trifluoromethyl)phenyl]imidazole |
| SMILES | [C-]#[N+]C1(c2cn(-c3ccc(-c4cccc(S(C)(=O)=O)c4)cc3)c(-c3ccccc3C(F)(F)F)n2)CCOCC1 |
| InChI | InChI=1S/C29H24F3N3O3S/c1-33-28(14-16-38-17-15-28)26-19-35(27(34-26)24-8-3-4-9-25(24)29(30,31)32)22-12-10-20(11-13-22)21-6-5-7-23(18-21)39(2,36)37/h3-13,18-19H,14-17H2,2H3 |
| InChIKey | JBBRAESRNGVKJQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 65.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|