C22H15Cl2IN2O2S — CID 59240328
2-(2,3-dichlorophenyl)-4-iodo-1-[4-(3-methylsulfonylphenyl)phenyl]imidazole (PubChem CID 59240328) has the molecular formula C22H15Cl2IN2O2S and a molecular weight of 569.25 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-iodo-1-[4-(3-methylsulfonylphenyl)phenyl]imidazole.
| Compound Name | 2-(2,3-dichlorophenyl)-4-iodo-1-[4-(3-methylsulfonylphenyl)phenyl]imidazole |
|---|---|
| PubChem CID | 59240328 |
| Molecular Formula | C22H15Cl2IN2O2S |
| Molecular Weight | 569.25 g/mol |
| Exact Mass | 567.93 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-iodo-1-[4-(3-methylsulfonylphenyl)phenyl]imidazole |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-n3cc(I)nc3-c3cccc(Cl)c3Cl)cc2)c1 |
| InChI | InChI=1S/C22H15Cl2IN2O2S/c1-30(28,29)17-5-2-4-15(12-17)14-8-10-16(11-9-14)27-13-20(25)26-22(27)18-6-3-7-19(23)21(18)24/h2-13H,1H3 |
| InChIKey | VLFHLOVCXVBWLW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.25 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|