C25H23ClN2O2S — CID 141164393
1-[2-chloro-4-(3-methylsulfonylphenyl)phenyl]-2-(2-propan-2-ylphenyl)imidazole (PubChem CID 141164393) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is 1-[2-chloro-4-(3-methylsulfonylphenyl)phenyl]-2-(2-propan-2-ylphenyl)imidazole.
| Compound Name | 1-[2-chloro-4-(3-methylsulfonylphenyl)phenyl]-2-(2-propan-2-ylphenyl)imidazole |
|---|---|
| PubChem CID | 141164393 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-[2-chloro-4-(3-methylsulfonylphenyl)phenyl]-2-(2-propan-2-ylphenyl)imidazole |
| SMILES | CC(C)c1ccccc1-c1nccn1-c1ccc(-c2cccc(S(C)(=O)=O)c2)cc1Cl |
| InChI | InChI=1S/C25H23ClN2O2S/c1-17(2)21-9-4-5-10-22(21)25-27-13-14-28(25)24-12-11-19(16-23(24)26)18-7-6-8-20(15-18)31(3,29)30/h4-17H,1-3H3 |
| InChIKey | YAMWXXDNUFSRGN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |