C27H28N2O2S — CID 141164467
2-[4-(3-ethylsulfonylphenyl)-2-methylphenyl]-1-(2-propan-2-ylphenyl)imidazole (PubChem CID 141164467) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[4-(3-ethylsulfonylphenyl)-2-methylphenyl]-1-(2-propan-2-ylphenyl)imidazole.
| Compound Name | 2-[4-(3-ethylsulfonylphenyl)-2-methylphenyl]-1-(2-propan-2-ylphenyl)imidazole |
|---|---|
| PubChem CID | 141164467 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[4-(3-ethylsulfonylphenyl)-2-methylphenyl]-1-(2-propan-2-ylphenyl)imidazole |
| SMILES | CCS(=O)(=O)c1cccc(-c2ccc(-c3nccn3-c3ccccc3C(C)C)c(C)c2)c1 |
| InChI | InChI=1S/C27H28N2O2S/c1-5-32(30,31)23-10-8-9-21(18-23)22-13-14-25(20(4)17-22)27-28-15-16-29(27)26-12-7-6-11-24(26)19(2)3/h6-19H,5H2,1-4H3 |
| InChIKey | LMEGCQLQQGZAJR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |