C10H18OS — CID 59243493
(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethylthian-2-one (PubChem CID 59243493) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-ethyl-3,4,5-trimethylthian-2-one.
| Compound Name | (3R,4S,5S,6R)-6-ethyl-3,4,5-trimethylthian-2-one |
|---|---|
| PubChem CID | 59243493 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (3R,4S,5S,6R)-6-ethyl-3,4,5-trimethylthian-2-one |
| SMILES | CC[C@H]1SC(=O)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H18OS/c1-5-9-7(3)6(2)8(4)10(11)12-9/h6-9H,5H2,1-4H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | FGQDZSZWDGMMCW-RBXMUDONSA-N |
| XLogP | 2.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|