C26H31N7O7S2 — CID 59248177
(2S)-3-[4-(2-aminoethoxy)phenyl]-2-[[(2S)-2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 59248177) has the molecular formula C26H31N7O7S2 and a molecular weight of 617.71 g/mol. Its IUPAC name is (2S)-3-[4-(2-aminoethoxy)phenyl]-2-[[(2S)-2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(2-aminoethoxy)phenyl]-2-[[(2S)-2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59248177 |
| Molecular Formula | C26H31N7O7S2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | (2S)-3-[4-(2-aminoethoxy)phenyl]-2-[[(2S)-2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(OCCN)cc1)C(=O)O)n1cc(COc2ccc3nc(SOON)sc3c2)nn1 |
| InChI | InChI=1S/C26H31N7O7S2/c1-15(2)23(24(34)29-21(25(35)36)11-16-3-5-18(6-4-16)37-10-9-27)33-13-17(31-32-33)14-38-19-7-8-20-22(12-19)41-26(30-20)42-40-39-28/h3-8,12-13,15,21,23H,9-11,14,27-28H2,1-2H3,(H,29,34)(H,35,36)/t21-,23-/m0/s1 |
| InChIKey | IVZZNJHCPOERBI-GMAHTHKFSA-N |
| XLogP | 2.64 |
| TPSA | 198.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|