C27H41N7O9S2 — CID 59552704
tert-butyl N-[3-[2-[2-[3-[[2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate (PubChem CID 59552704) has the molecular formula C27H41N7O9S2 and a molecular weight of 671.80 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[3-[[2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[3-[[2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate |
|---|---|
| PubChem CID | 59552704 |
| Molecular Formula | C27H41N7O9S2 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[3-[[2-[4-[(2-aminoperoxysulfanyl-1,3-benzothiazol-6-yl)oxymethyl]triazol-1-yl]acetyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOCCOCCOCCCNC(=O)Cn1cc(COc2ccc3nc(SOON)sc3c2)nn1 |
| InChI | InChI=1S/C27H41N7O9S2/c1-27(2,3)41-25(36)30-9-5-11-38-13-15-39-14-12-37-10-4-8-29-24(35)18-34-17-20(32-33-34)19-40-21-6-7-22-23(16-21)44-26(31-22)45-43-42-28/h6-7,16-17H,4-5,8-15,18-19,28H2,1-3H3,(H,29,35)(H,30,36) |
| InChIKey | OSOZLRQLUZJASS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|