C25H16N4O2 — CID 59248366
15-[(4-methylphenyl)hydrazinylidene]-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,16(20),17-octaene-11,14-dione (PubChem CID 59248366) has the molecular formula C25H16N4O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 15-[(4-methylphenyl)hydrazinylidene]-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,16(20),17-octaene-11,14-dione.
| Compound Name | 15-[(4-methylphenyl)hydrazinylidene]-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,16(20),17-octaene-11,14-dione |
|---|---|
| PubChem CID | 59248366 |
| Molecular Formula | C25H16N4O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 15-[(4-methylphenyl)hydrazinylidene]-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12,16(20),17-octaene-11,14-dione |
| SMILES | Cc1ccc(NN=c2c(=O)cc3c(=O)n4c5ccccc5nc4c4cccc2c34)cc1 |
| InChI | InChI=1S/C25H16N4O2/c1-14-9-11-15(12-10-14)27-28-23-16-5-4-6-17-22(16)18(13-21(23)30)25(31)29-20-8-3-2-7-19(20)26-24(17)29/h2-13,27H,1H3 |
| InChIKey | YJPYPDFDKIUMNY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|