C14H25NO2 — CID 59249405
tert-butyl 2-[(3-cyclopropyl-3-methylbutylidene)amino]acetate (PubChem CID 59249405) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is tert-butyl 2-[(3-cyclopropyl-3-methylbutylidene)amino]acetate.
| Compound Name | tert-butyl 2-[(3-cyclopropyl-3-methylbutylidene)amino]acetate |
|---|---|
| PubChem CID | 59249405 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | tert-butyl 2-[(3-cyclopropyl-3-methylbutylidene)amino]acetate |
| SMILES | CC(C)(C)OC(=O)C/N=C/CC(C)(C)C1CC1 |
| InChI | InChI=1S/C14H25NO2/c1-13(2,3)17-12(16)10-15-9-8-14(4,5)11-6-7-11/h9,11H,6-8,10H2,1-5H3/b15-9+ |
| InChIKey | HWTORJWBIDIZBA-OQLLNIDSSA-N |
| XLogP | 3.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|